C20H23N5O3S — CID 135930226
(9R)-9-(3-nitrophenyl)-2-pentylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135930226) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is (9R)-9-(3-nitrophenyl)-2-pentylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(3-nitrophenyl)-2-pentylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135930226 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (9R)-9-(3-nitrophenyl)-2-pentylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCCSc1nc2n(n1)[C@H](c1cccc([N+](=O)[O-])c1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C20H23N5O3S/c1-2-3-4-11-29-20-22-19-21-15-9-6-10-16(26)17(15)18(24(19)23-20)13-7-5-8-14(12-13)25(27)28/h5,7-8,12,18H,2-4,6,9-11H2,1H3,(H,21,22,23)/t18-/m1/s1 |
| InChIKey | LGHNMZNBWASIGR-GOSISDBHSA-N |
| XLogP | 4.49 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|