C21H26N4OS — CID 136833738
(9S)-9-(4-methylphenyl)-2-pentylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136833738) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is (9S)-9-(4-methylphenyl)-2-pentylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9S)-9-(4-methylphenyl)-2-pentylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136833738 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (9S)-9-(4-methylphenyl)-2-pentylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCCSc1nc2n(n1)[C@@H](c1ccc(C)cc1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C21H26N4OS/c1-3-4-5-13-27-21-23-20-22-16-7-6-8-17(26)18(16)19(25(20)24-21)15-11-9-14(2)10-12-15/h9-12,19H,3-8,13H2,1-2H3,(H,22,23,24)/t19-/m0/s1 |
| InChIKey | HRECNVSDBITWNY-IBGZPJMESA-N |
| XLogP | 4.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|