C18H22N4OS2 — CID 135468967
2-pentylsulfanyl-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135468967) has the molecular formula C18H22N4OS2 and a molecular weight of 374.54 g/mol. Its IUPAC name is 2-pentylsulfanyl-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-pentylsulfanyl-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135468967 |
| Molecular Formula | C18H22N4OS2 |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-pentylsulfanyl-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCCSc1nc2n(n1)C(c1cccs1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C18H22N4OS2/c1-2-3-4-10-25-18-20-17-19-12-7-5-8-13(23)15(12)16(22(17)21-18)14-9-6-11-24-14/h6,9,11,16H,2-5,7-8,10H2,1H3,(H,19,20,21) |
| InChIKey | UJVABBOEMKTLBY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|