C17H19BrN4O2S — CID 135693933
9-(5-bromofuran-2-yl)-2-butylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135693933) has the molecular formula C17H19BrN4O2S and a molecular weight of 423.34 g/mol. Its IUPAC name is 9-(5-bromofuran-2-yl)-2-butylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(5-bromofuran-2-yl)-2-butylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135693933 |
| Molecular Formula | C17H19BrN4O2S |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 9-(5-bromofuran-2-yl)-2-butylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCSc1nc2n(n1)C(c1ccc(Br)o1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C17H19BrN4O2S/c1-2-3-9-25-17-20-16-19-10-5-4-6-11(23)14(10)15(22(16)21-17)12-7-8-13(18)24-12/h7-8,15H,2-6,9H2,1H3,(H,19,20,21) |
| InChIKey | BFUXNXZOXHQETG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|