C19H21FN4OS — CID 135609822
2-butylsulfanyl-9-(4-fluorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135609822) has the molecular formula C19H21FN4OS and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-butylsulfanyl-9-(4-fluorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-butylsulfanyl-9-(4-fluorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135609822 |
| Molecular Formula | C19H21FN4OS |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-butylsulfanyl-9-(4-fluorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCSc1nc2n(n1)C(c1ccc(F)cc1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C19H21FN4OS/c1-2-3-11-26-19-22-18-21-14-5-4-6-15(25)16(14)17(24(18)23-19)12-7-9-13(20)10-8-12/h7-10,17H,2-6,11H2,1H3,(H,21,22,23) |
| InChIKey | AVDPAPXNTNLKGU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|