C20H17ClN4OS2 — CID 136761831
(9S)-2-[(4-chlorophenyl)methylsulfanyl]-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136761831) has the molecular formula C20H17ClN4OS2 and a molecular weight of 428.97 g/mol. Its IUPAC name is (9S)-2-[(4-chlorophenyl)methylsulfanyl]-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9S)-2-[(4-chlorophenyl)methylsulfanyl]-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136761831 |
| Molecular Formula | C20H17ClN4OS2 |
| Molecular Weight | 428.97 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | (9S)-2-[(4-chlorophenyl)methylsulfanyl]-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CCCC2=C1[C@@H](c1cccs1)n1nc(SCc3ccc(Cl)cc3)nc1N2 |
| InChI | InChI=1S/C20H17ClN4OS2/c21-13-8-6-12(7-9-13)11-28-20-23-19-22-14-3-1-4-15(26)17(14)18(25(19)24-20)16-5-2-10-27-16/h2,5-10,18H,1,3-4,11H2,(H,22,23,24)/t18-/m1/s1 |
| InChIKey | NRXZLRQOWQBRAK-GOSISDBHSA-N |
| XLogP | 5.31 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.97 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |