C15H16N4OS2 — CID 135611563
(9S)-2-ethylsulfanyl-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135611563) has the molecular formula C15H16N4OS2 and a molecular weight of 332.45 g/mol. Its IUPAC name is (9S)-2-ethylsulfanyl-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9S)-2-ethylsulfanyl-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135611563 |
| Molecular Formula | C15H16N4OS2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (9S)-2-ethylsulfanyl-9-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCSc1nc2n(n1)[C@H](c1cccs1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C15H16N4OS2/c1-2-21-15-17-14-16-9-5-3-6-10(20)12(9)13(19(14)18-15)11-7-4-8-22-11/h4,7-8,13H,2-3,5-6H2,1H3,(H,16,17,18)/t13-/m1/s1 |
| InChIKey | ADVOKHDHHKZQMR-CYBMUJFWSA-N |
| XLogP | 3.47 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |