C23H21N5O3 — CID 135593077
2-(3,4-dimethylphenyl)-9-(3-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135593077) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-9-(3-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-(3,4-dimethylphenyl)-9-(3-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135593077 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-9-(3-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccc(-c2nc3n(n2)C(c2cccc([N+](=O)[O-])c2)C2=C(CCCC2=O)N3)cc1C |
| InChI | InChI=1S/C23H21N5O3/c1-13-9-10-16(11-14(13)2)22-25-23-24-18-7-4-8-19(29)20(18)21(27(23)26-22)15-5-3-6-17(12-15)28(30)31/h3,5-6,9-12,21H,4,7-8H2,1-2H3,(H,24,25,26) |
| InChIKey | QTWRRECTZHUPPS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|