C23H21N5O5 — CID 135736783
9-(3-ethoxy-4-hydroxyphenyl)-2-(3-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135736783) has the molecular formula C23H21N5O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is 9-(3-ethoxy-4-hydroxyphenyl)-2-(3-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(3-ethoxy-4-hydroxyphenyl)-2-(3-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135736783 |
| Molecular Formula | C23H21N5O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 9-(3-ethoxy-4-hydroxyphenyl)-2-(3-nitrophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)Nc3nc(-c4cccc([N+](=O)[O-])c4)nn32)ccc1O |
| InChI | InChI=1S/C23H21N5O5/c1-2-33-19-12-13(9-10-17(19)29)21-20-16(7-4-8-18(20)30)24-23-25-22(26-27(21)23)14-5-3-6-15(11-14)28(31)32/h3,5-6,9-12,21,29H,2,4,7-8H2,1H3,(H,24,25,26) |
| InChIKey | KPHJXRBJVQQILB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|