C22H22N4OS — CID 135824882
2-(3,4-dimethylphenyl)-9-(3-methylthiophen-2-yl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135824882) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-9-(3-methylthiophen-2-yl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-(3,4-dimethylphenyl)-9-(3-methylthiophen-2-yl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135824882 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-9-(3-methylthiophen-2-yl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccc(-c2nc3n(n2)C(c2sccc2C)C2=C(CCCC2=O)N3)cc1C |
| InChI | InChI=1S/C22H22N4OS/c1-12-7-8-15(11-14(12)3)21-24-22-23-16-5-4-6-17(27)18(16)19(26(22)25-21)20-13(2)9-10-28-20/h7-11,19H,4-6H2,1-3H3,(H,23,24,25) |
| InChIKey | XGOGKNHRJMXAOP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |