C24H27N5OS — CID 135843336
2-[4-(dimethylamino)phenyl]-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135843336) has the molecular formula C24H27N5OS and a molecular weight of 433.58 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-[4-(dimethylamino)phenyl]-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135843336 |
| Molecular Formula | C24H27N5OS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccsc1C1C2=C(CC(C)(C)CC2=O)Nc2nc(-c3ccc(N(C)C)cc3)nn21 |
| InChI | InChI=1S/C24H27N5OS/c1-14-10-11-31-21(14)20-19-17(12-24(2,3)13-18(19)30)25-23-26-22(27-29(20)23)15-6-8-16(9-7-15)28(4)5/h6-11,20H,12-13H2,1-5H3,(H,25,26,27) |
| InChIKey | QRPNRXVEYKYCOR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |