C25H26FN5O — CID 135685956
2-[4-(dimethylamino)phenyl]-9-(4-fluorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135685956) has the molecular formula C25H26FN5O and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-9-(4-fluorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-[4-(dimethylamino)phenyl]-9-(4-fluorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135685956 |
| Molecular Formula | C25H26FN5O |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-9-(4-fluorophenyl)-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CN(C)c1ccc(-c2nc3n(n2)C(c2ccc(F)cc2)C2=C(CC(C)(C)CC2=O)N3)cc1 |
| InChI | InChI=1S/C25H26FN5O/c1-25(2)13-19-21(20(32)14-25)22(15-5-9-17(26)10-6-15)31-24(27-19)28-23(29-31)16-7-11-18(12-8-16)30(3)4/h5-12,22H,13-14H2,1-4H3,(H,27,28,29) |
| InChIKey | BPOXOWAOFKAEFF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |