C25H26N4O2 — CID 135700234
2-(2-methoxyphenyl)-6,6-dimethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135700234) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-6,6-dimethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-(2-methoxyphenyl)-6,6-dimethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135700234 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-(2-methoxyphenyl)-6,6-dimethyl-9-(4-methylphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1ccccc1-c1nc2n(n1)C(c1ccc(C)cc1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C25H26N4O2/c1-15-9-11-16(12-10-15)22-21-18(13-25(2,3)14-19(21)30)26-24-27-23(28-29(22)24)17-7-5-6-8-20(17)31-4/h5-12,22H,13-14H2,1-4H3,(H,26,27,28) |
| InChIKey | FZVSFOGMDGWJIR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |