C26H27ClN4O4 — CID 135755885
2-(2-chlorophenyl)-6,6-dimethyl-9-(3,4,5-trimethoxyphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135755885) has the molecular formula C26H27ClN4O4 and a molecular weight of 494.98 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-6,6-dimethyl-9-(3,4,5-trimethoxyphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-(2-chlorophenyl)-6,6-dimethyl-9-(3,4,5-trimethoxyphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135755885 |
| Molecular Formula | C26H27ClN4O4 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 2-(2-chlorophenyl)-6,6-dimethyl-9-(3,4,5-trimethoxyphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(-c4ccccc4Cl)nn32)cc(OC)c1OC |
| InChI | InChI=1S/C26H27ClN4O4/c1-26(2)12-17-21(18(32)13-26)22(14-10-19(33-3)23(35-5)20(11-14)34-4)31-25(28-17)29-24(30-31)15-8-6-7-9-16(15)27/h6-11,22H,12-13H2,1-5H3,(H,28,29,30) |
| InChIKey | SNKASMSBLMZONW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |