C25H27N5O4 — CID 135772554
6,6-dimethyl-9-pyridin-3-yl-2-(3,4,5-trimethoxyphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135772554) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is 6,6-dimethyl-9-pyridin-3-yl-2-(3,4,5-trimethoxyphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 6,6-dimethyl-9-pyridin-3-yl-2-(3,4,5-trimethoxyphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135772554 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 6,6-dimethyl-9-pyridin-3-yl-2-(3,4,5-trimethoxyphenyl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cc(-c2nc3n(n2)C(c2cccnc2)C2=C(CC(C)(C)CC2=O)N3)cc(OC)c1OC |
| InChI | InChI=1S/C25H27N5O4/c1-25(2)11-16-20(17(31)12-25)21(14-7-6-8-26-13-14)30-24(27-16)28-23(29-30)15-9-18(32-3)22(34-5)19(10-15)33-4/h6-10,13,21H,11-12H2,1-5H3,(H,27,28,29) |
| InChIKey | CNGFJPRTFZOCJZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |