C27H24N4O2 — CID 135779378
9-(4-hydroxyphenyl)-6,6-dimethyl-2-naphthalen-1-yl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135779378) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 9-(4-hydroxyphenyl)-6,6-dimethyl-2-naphthalen-1-yl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(4-hydroxyphenyl)-6,6-dimethyl-2-naphthalen-1-yl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135779378 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 9-(4-hydroxyphenyl)-6,6-dimethyl-2-naphthalen-1-yl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(-c3cccc4ccccc34)nn1C2c1ccc(O)cc1 |
| InChI | InChI=1S/C27H24N4O2/c1-27(2)14-21-23(22(33)15-27)24(17-10-12-18(32)13-11-17)31-26(28-21)29-25(30-31)20-9-5-7-16-6-3-4-8-19(16)20/h3-13,24,32H,14-15H2,1-2H3,(H,28,29,30) |
| InChIKey | VHCYGHGLHZCXGX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |