C26H30N4O2 — CID 135832309
2-(4-tert-butylphenyl)-6,6-dimethyl-9-(5-methylfuran-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135832309) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-6,6-dimethyl-9-(5-methylfuran-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-(4-tert-butylphenyl)-6,6-dimethyl-9-(5-methylfuran-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135832309 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 2-(4-tert-butylphenyl)-6,6-dimethyl-9-(5-methylfuran-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(-c4ccc(C(C)(C)C)cc4)nn32)o1 |
| InChI | InChI=1S/C26H30N4O2/c1-15-7-12-20(32-15)22-21-18(13-26(5,6)14-19(21)31)27-24-28-23(29-30(22)24)16-8-10-17(11-9-16)25(2,3)4/h7-12,22H,13-14H2,1-6H3,(H,27,28,29) |
| InChIKey | GJHWQKQBEOFABB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |