C24H26N4O3 — CID 135670492
2-(4-ethoxyphenyl)-6,6-dimethyl-9-(5-methylfuran-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135670492) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-6,6-dimethyl-9-(5-methylfuran-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-(4-ethoxyphenyl)-6,6-dimethyl-9-(5-methylfuran-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135670492 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-(4-ethoxyphenyl)-6,6-dimethyl-9-(5-methylfuran-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCOc1ccc(-c2nc3n(n2)C(c2ccc(C)o2)C2=C(CC(C)(C)CC2=O)N3)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-5-30-16-9-7-15(8-10-16)22-26-23-25-17-12-24(3,4)13-18(29)20(17)21(28(23)27-22)19-11-6-14(2)31-19/h6-11,21H,5,12-13H2,1-4H3,(H,25,26,27) |
| InChIKey | CAVALHBDQAKAIU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |