C22H21ClN4OS — CID 135824968
2-(2-chlorophenyl)-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135824968) has the molecular formula C22H21ClN4OS and a molecular weight of 424.96 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-(2-chlorophenyl)-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135824968 |
| Molecular Formula | C22H21ClN4OS |
| Molecular Weight | 424.96 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-(2-chlorophenyl)-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccsc1C1C2=C(CC(C)(C)CC2=O)Nc2nc(-c3ccccc3Cl)nn21 |
| InChI | InChI=1S/C22H21ClN4OS/c1-12-8-9-29-19(12)18-17-15(10-22(2,3)11-16(17)28)24-21-25-20(26-27(18)21)13-6-4-5-7-14(13)23/h4-9,18H,10-11H2,1-3H3,(H,24,25,26) |
| InChIKey | SCAANMDWXPVXPB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.96 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |