C20H20N4O2S — CID 135796174
2-(furan-2-yl)-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135796174) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-(furan-2-yl)-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-(furan-2-yl)-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135796174 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-(furan-2-yl)-6,6-dimethyl-9-(3-methylthiophen-2-yl)-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccsc1C1C2=C(CC(C)(C)CC2=O)Nc2nc(-c3ccco3)nn21 |
| InChI | InChI=1S/C20H20N4O2S/c1-11-6-8-27-17(11)16-15-12(9-20(2,3)10-13(15)25)21-19-22-18(23-24(16)19)14-5-4-7-26-14/h4-8,16H,9-10H2,1-3H3,(H,21,22,23) |
| InChIKey | HLVJHJKOVHBFQU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |