C21H21N5OS — CID 135848340
6,6-dimethyl-9-(3-methylthiophen-2-yl)-2-pyridin-4-yl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135848340) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is 6,6-dimethyl-9-(3-methylthiophen-2-yl)-2-pyridin-4-yl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 6,6-dimethyl-9-(3-methylthiophen-2-yl)-2-pyridin-4-yl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135848340 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 6,6-dimethyl-9-(3-methylthiophen-2-yl)-2-pyridin-4-yl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccsc1C1C2=C(CC(C)(C)CC2=O)Nc2nc(-c3ccncc3)nn21 |
| InChI | InChI=1S/C21H21N5OS/c1-12-6-9-28-18(12)17-16-14(10-21(2,3)11-15(16)27)23-20-24-19(25-26(17)20)13-4-7-22-8-5-13/h4-9,17H,10-11H2,1-3H3,(H,23,24,25) |
| InChIKey | ALYNQIBPMFVYMF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |