C29H25ClN4O2S — CID 135663170
2-[(2-chlorophenyl)methylsulfanyl]-9-(3-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135663170) has the molecular formula C29H25ClN4O2S and a molecular weight of 529.07 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-9-(3-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-9-(3-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135663170 |
| Molecular Formula | C29H25ClN4O2S |
| Molecular Weight | 529.07 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-9-(3-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CCCC2=C1C(c1cccc(OCc3ccccc3)c1)n1nc(SCc3ccccc3Cl)nc1N2 |
| InChI | InChI=1S/C29H25ClN4O2S/c30-23-13-5-4-10-21(23)18-37-29-32-28-31-24-14-7-15-25(35)26(24)27(34(28)33-29)20-11-6-12-22(16-20)36-17-19-8-2-1-3-9-19/h1-6,8-13,16,27H,7,14-15,17-18H2,(H,31,32,33) |
| InChIKey | AUTBYWZUHRUFNR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.07 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |