C22H17Cl3N4OS — CID 135662977
2-[(2-chlorophenyl)methylsulfanyl]-9-(2,6-dichlorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135662977) has the molecular formula C22H17Cl3N4OS and a molecular weight of 491.83 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-9-(2,6-dichlorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-9-(2,6-dichlorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135662977 |
| Molecular Formula | C22H17Cl3N4OS |
| Molecular Weight | 491.83 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-9-(2,6-dichlorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CCCC2=C1C(c1c(Cl)cccc1Cl)n1nc(SCc3ccccc3Cl)nc1N2 |
| InChI | InChI=1S/C22H17Cl3N4OS/c23-13-6-2-1-5-12(13)11-31-22-27-21-26-16-9-4-10-17(30)19(16)20(29(21)28-22)18-14(24)7-3-8-15(18)25/h1-3,5-8,20H,4,9-11H2,(H,26,27,28) |
| InChIKey | GOKSAELDOMOOFM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.83 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |