C24H24N4OS — CID 135609789
9-(4-methylphenyl)-2-[(2-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135609789) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is 9-(4-methylphenyl)-2-[(2-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(4-methylphenyl)-2-[(2-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135609789 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 9-(4-methylphenyl)-2-[(2-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccc(C2C3=C(CCCC3=O)Nc3nc(SCc4ccccc4C)nn32)cc1 |
| InChI | InChI=1S/C24H24N4OS/c1-15-10-12-17(13-11-15)22-21-19(8-5-9-20(21)29)25-23-26-24(27-28(22)23)30-14-18-7-4-3-6-16(18)2/h3-4,6-7,10-13,22H,5,8-9,14H2,1-2H3,(H,25,26,27) |
| InChIKey | VWNAMPBLITWVJO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |