C25H26N4O3S — CID 136761690
(9R)-9-(2,3-dimethoxyphenyl)-2-[(2-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136761690) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is (9R)-9-(2,3-dimethoxyphenyl)-2-[(2-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(2,3-dimethoxyphenyl)-2-[(2-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136761690 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (9R)-9-(2,3-dimethoxyphenyl)-2-[(2-methylphenyl)methylsulfanyl]-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cccc([C@@H]2C3=C(CCCC3=O)Nc3nc(SCc4ccccc4C)nn32)c1OC |
| InChI | InChI=1S/C25H26N4O3S/c1-15-8-4-5-9-16(15)14-33-25-27-24-26-18-11-7-12-19(30)21(18)22(29(24)28-25)17-10-6-13-20(31-2)23(17)32-3/h4-6,8-10,13,22H,7,11-12,14H2,1-3H3,(H,26,27,28)/t22-/m1/s1 |
| InChIKey | DUJIPFDQCZWWMD-JOCHJYFZSA-N |
| XLogP | 4.92 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |