C23H30N4O3S — CID 135696110
9-(3,4-diethoxyphenyl)-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135696110) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 9-(3,4-diethoxyphenyl)-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(3,4-diethoxyphenyl)-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135696110 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 9-(3,4-diethoxyphenyl)-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCOc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCC)nn32)cc1OCC |
| InChI | InChI=1S/C23H30N4O3S/c1-6-29-17-10-9-14(11-18(17)30-7-2)20-19-15(12-23(4,5)13-16(19)28)24-21-25-22(31-8-3)26-27(20)21/h9-11,20H,6-8,12-13H2,1-5H3,(H,24,25,26) |
| InChIKey | LCMCQYFKUJIQAL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |