C27H38N4O3S — CID 135694005
9-(4-butoxy-3-ethoxyphenyl)-2-butylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135694005) has the molecular formula C27H38N4O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is 9-(4-butoxy-3-ethoxyphenyl)-2-butylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(4-butoxy-3-ethoxyphenyl)-2-butylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135694005 |
| Molecular Formula | C27H38N4O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 9-(4-butoxy-3-ethoxyphenyl)-2-butylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCCOc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCCCC)nn32)cc1OCC |
| InChI | InChI=1S/C27H38N4O3S/c1-6-9-13-34-21-12-11-18(15-22(21)33-8-3)24-23-19(16-27(4,5)17-20(23)32)28-25-29-26(30-31(24)25)35-14-10-7-2/h11-12,15,24H,6-10,13-14,16-17H2,1-5H3,(H,28,29,30) |
| InChIKey | KNMYOUFQJSDYOS-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|