C26H36N4O3S — CID 135806762
9-[3-methoxy-4-(3-methylbutoxy)phenyl]-6,6-dimethyl-2-propylsulfanyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135806762) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is 9-[3-methoxy-4-(3-methylbutoxy)phenyl]-6,6-dimethyl-2-propylsulfanyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-[3-methoxy-4-(3-methylbutoxy)phenyl]-6,6-dimethyl-2-propylsulfanyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135806762 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 9-[3-methoxy-4-(3-methylbutoxy)phenyl]-6,6-dimethyl-2-propylsulfanyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCCSc1nc2n(n1)C(c1ccc(OCCC(C)C)c(OC)c1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C26H36N4O3S/c1-7-12-34-25-28-24-27-18-14-26(4,5)15-19(31)22(18)23(30(24)29-25)17-8-9-20(21(13-17)32-6)33-11-10-16(2)3/h8-9,13,16,23H,7,10-12,14-15H2,1-6H3,(H,27,28,29) |
| InChIKey | DSGVZWGWEOBZIL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |