C10H4Cl2N2O4 — CID 7109767
3,4-dichloro-1-(4-nitrophenyl)pyrrole-2,5-dione (PubChem CID 7109767) has the molecular formula C10H4Cl2N2O4 and a molecular weight of 287.06 g/mol. Its IUPAC name is 3,4-dichloro-1-(4-nitrophenyl)pyrrole-2,5-dione.
| Compound Name | 3,4-dichloro-1-(4-nitrophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 7109767 |
| Molecular Formula | C10H4Cl2N2O4 |
| Molecular Weight | 287.06 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | 3,4-dichloro-1-(4-nitrophenyl)pyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H4Cl2N2O4/c11-7-8(12)10(16)13(9(7)15)5-1-3-6(4-2-5)14(17)18/h1-4H |
| InChIKey | SPLZVLAXCUUTFU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.06 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|