C12H8N2O6 — CID 98392481
(4R)-4-acetyl-1-(4-nitrophenyl)pyrrolidine-2,3,5-trione (PubChem CID 98392481) has the molecular formula C12H8N2O6 and a molecular weight of 276.20 g/mol. Its IUPAC name is (4R)-4-acetyl-1-(4-nitrophenyl)pyrrolidine-2,3,5-trione.
| Compound Name | (4R)-4-acetyl-1-(4-nitrophenyl)pyrrolidine-2,3,5-trione |
|---|---|
| PubChem CID | 98392481 |
| Molecular Formula | C12H8N2O6 |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (4R)-4-acetyl-1-(4-nitrophenyl)pyrrolidine-2,3,5-trione |
| SMILES | CC(=O)[C@@H]1C(=O)C(=O)N(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C12H8N2O6/c1-6(15)9-10(16)12(18)13(11(9)17)7-2-4-8(5-3-7)14(19)20/h2-5,9H,1H3/t9-/m1/s1 |
| InChIKey | GCYDNJITIMNAEB-SECBINFHSA-N |
| XLogP | 0.24 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|