C17H12N4O6 — CID 134156117
1-(4-nitrophenyl)-2,4,6-trioxo-N-phenyl-1,3-diazinane-5-carboxamide (PubChem CID 134156117) has the molecular formula C17H12N4O6 and a molecular weight of 368.31 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-2,4,6-trioxo-N-phenyl-1,3-diazinane-5-carboxamide.
| Compound Name | 1-(4-nitrophenyl)-2,4,6-trioxo-N-phenyl-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 134156117 |
| Molecular Formula | C17H12N4O6 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1-(4-nitrophenyl)-2,4,6-trioxo-N-phenyl-1,3-diazinane-5-carboxamide |
| SMILES | O=C1NC(=O)N(c2ccc([N+](=O)[O-])cc2)C(=O)C1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H12N4O6/c22-14(18-10-4-2-1-3-5-10)13-15(23)19-17(25)20(16(13)24)11-6-8-12(9-7-11)21(26)27/h1-9,13H,(H,18,22)(H,19,23,25) |
| InChIKey | KPMJJVZICTZUCF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|