C30H24N4O6 — CID 122396351
2,4-bis(4-nitrophenyl)-1-N,3-N-diphenylcyclobutane-1,3-dicarboxamide (PubChem CID 122396351) has the molecular formula C30H24N4O6 and a molecular weight of 536.54 g/mol. Its IUPAC name is 2,4-bis(4-nitrophenyl)-1-N,3-N-diphenylcyclobutane-1,3-dicarboxamide.
| Compound Name | 2,4-bis(4-nitrophenyl)-1-N,3-N-diphenylcyclobutane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 122396351 |
| Molecular Formula | C30H24N4O6 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 2,4-bis(4-nitrophenyl)-1-N,3-N-diphenylcyclobutane-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)C1C(c2ccc([N+](=O)[O-])cc2)C(C(=O)Nc2ccccc2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H24N4O6/c35-29(31-21-7-3-1-4-8-21)27-25(19-11-15-23(16-12-19)33(37)38)28(30(36)32-22-9-5-2-6-10-22)26(27)20-13-17-24(18-14-20)34(39)40/h1-18,25-28H,(H,31,35)(H,32,36) |
| InChIKey | PJPMBHIPRIUBBU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|