C18H14FN5O5 — CID 134143529
1-(4-fluorophenyl)-3-[(2,4,6-trioxo-1-phenyl-1,3-diazinane-5-carbonyl)amino]urea (PubChem CID 134143529) has the molecular formula C18H14FN5O5 and a molecular weight of 399.34 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(2,4,6-trioxo-1-phenyl-1,3-diazinane-5-carbonyl)amino]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[(2,4,6-trioxo-1-phenyl-1,3-diazinane-5-carbonyl)amino]urea |
|---|---|
| PubChem CID | 134143529 |
| Molecular Formula | C18H14FN5O5 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(2,4,6-trioxo-1-phenyl-1,3-diazinane-5-carbonyl)amino]urea |
| SMILES | O=C(NNC(=O)C1C(=O)NC(=O)N(c2ccccc2)C1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FN5O5/c19-10-6-8-11(9-7-10)20-17(28)23-22-15(26)13-14(25)21-18(29)24(16(13)27)12-4-2-1-3-5-12/h1-9,13H,(H,22,26)(H2,20,23,28)(H,21,25,29) |
| InChIKey | KFEUYIABWCHBAY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|