C9H10FN3O3 — CID 24535891
methyl N-[(4-fluorophenyl)carbamoylamino]carbamate (PubChem CID 24535891) has the molecular formula C9H10FN3O3 and a molecular weight of 227.20 g/mol. Its IUPAC name is methyl N-[(4-fluorophenyl)carbamoylamino]carbamate.
| Compound Name | methyl N-[(4-fluorophenyl)carbamoylamino]carbamate |
|---|---|
| PubChem CID | 24535891 |
| Molecular Formula | C9H10FN3O3 |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | methyl N-[(4-fluorophenyl)carbamoylamino]carbamate |
| SMILES | COC(=O)NNC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C9H10FN3O3/c1-16-9(15)13-12-8(14)11-7-4-2-6(10)3-5-7/h2-5H,1H3,(H,13,15)(H2,11,12,14) |
| InChIKey | PICSNCSKUKGBSE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|