C9H10BrN3O2S — CID 971874
methyl N-[(4-bromophenyl)carbamothioylamino]carbamate (PubChem CID 971874) has the molecular formula C9H10BrN3O2S and a molecular weight of 304.17 g/mol. Its IUPAC name is methyl N-[(4-bromophenyl)carbamothioylamino]carbamate.
| Compound Name | methyl N-[(4-bromophenyl)carbamothioylamino]carbamate |
|---|---|
| PubChem CID | 971874 |
| Molecular Formula | C9H10BrN3O2S |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | methyl N-[(4-bromophenyl)carbamothioylamino]carbamate |
| SMILES | COC(=O)NNC(=S)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H10BrN3O2S/c1-15-9(14)13-12-8(16)11-7-4-2-6(10)3-5-7/h2-5H,1H3,(H,13,14)(H2,11,12,16) |
| InChIKey | FVAWDQADUKXFRJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|