C14H21N3O2S — CID 7988138
tert-butyl N-[(4-ethylphenyl)carbamothioylamino]carbamate (PubChem CID 7988138) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is tert-butyl N-[(4-ethylphenyl)carbamothioylamino]carbamate.
| Compound Name | tert-butyl N-[(4-ethylphenyl)carbamothioylamino]carbamate |
|---|---|
| PubChem CID | 7988138 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | tert-butyl N-[(4-ethylphenyl)carbamothioylamino]carbamate |
| SMILES | CCc1ccc(NC(=S)NNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H21N3O2S/c1-5-10-6-8-11(9-7-10)15-12(20)16-17-13(18)19-14(2,3)4/h6-9H,5H2,1-4H3,(H,17,18)(H2,15,16,20) |
| InChIKey | YKHOAIAIEBRDAO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|