C12H7N3O8 — CID 98392639
(4S)-4-acetyl-1-(2,4-dinitrophenyl)pyrrolidine-2,3,5-trione (PubChem CID 98392639) has the molecular formula C12H7N3O8 and a molecular weight of 321.20 g/mol. Its IUPAC name is (4S)-4-acetyl-1-(2,4-dinitrophenyl)pyrrolidine-2,3,5-trione.
| Compound Name | (4S)-4-acetyl-1-(2,4-dinitrophenyl)pyrrolidine-2,3,5-trione |
|---|---|
| PubChem CID | 98392639 |
| Molecular Formula | C12H7N3O8 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | (4S)-4-acetyl-1-(2,4-dinitrophenyl)pyrrolidine-2,3,5-trione |
| SMILES | CC(=O)[C@H]1C(=O)C(=O)N(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C12H7N3O8/c1-5(16)9-10(17)12(19)13(11(9)18)7-3-2-6(14(20)21)4-8(7)15(22)23/h2-4,9H,1H3/t9-/m0/s1 |
| InChIKey | GDWGCHQDHZKFNW-VIFPVBQESA-N |
| XLogP | 0.15 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|