C21H17N3O9 — CID 44887974
dimethyl (10R,11S)-12-(2,4-dinitrophenyl)-8-oxo-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10,11-dicarboxylate (PubChem CID 44887974) has the molecular formula C21H17N3O9 and a molecular weight of 455.38 g/mol. Its IUPAC name is dimethyl (10R,11S)-12-(2,4-dinitrophenyl)-8-oxo-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10,11-dicarboxylate.
| Compound Name | dimethyl (10R,11S)-12-(2,4-dinitrophenyl)-8-oxo-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 44887974 |
| Molecular Formula | C21H17N3O9 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | dimethyl (10R,11S)-12-(2,4-dinitrophenyl)-8-oxo-12-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-10,11-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C2c3ccccc3C(=O)C([C@@H]1C(=O)OC)N2c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N3O9/c1-32-20(26)15-16(21(27)33-2)18-19(25)12-6-4-3-5-11(12)17(15)22(18)13-8-7-10(23(28)29)9-14(13)24(30)31/h3-9,15-18H,1-2H3/t15-,16+,17?,18?/m0/s1 |
| InChIKey | BGYBTUBSCMHPRL-KNXWPPODSA-N |
| XLogP | 2.21 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|