C17H17N3O6 — CID 54770514
ethyl (1S,4S,6R,7S,9S)-8-(2,4-dinitrophenyl)-8-azatetracyclo[4.3.0.02,4.03,7]nonane-9-carboxylate (PubChem CID 54770514) has the molecular formula C17H17N3O6 and a molecular weight of 359.34 g/mol. Its IUPAC name is ethyl (1S,4S,6R,7S,9S)-8-(2,4-dinitrophenyl)-8-azatetracyclo[4.3.0.02,4.03,7]nonane-9-carboxylate.
| Compound Name | ethyl (1S,4S,6R,7S,9S)-8-(2,4-dinitrophenyl)-8-azatetracyclo[4.3.0.02,4.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 54770514 |
| Molecular Formula | C17H17N3O6 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | ethyl (1S,4S,6R,7S,9S)-8-(2,4-dinitrophenyl)-8-azatetracyclo[4.3.0.02,4.03,7]nonane-9-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C3C4C[C@H]2[C@@H](C43)N1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N3O6/c1-2-26-17(21)16-14-9-6-8-12(14)13(8)15(9)18(16)10-4-3-7(19(22)23)5-11(10)20(24)25/h3-5,8-9,12-16H,2,6H2,1H3/t8?,9-,12?,13?,14-,15+,16+/m1/s1 |
| InChIKey | CLBGRLWMRFNXPE-BFKXVABASA-N |
| XLogP | 2.14 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|