C15H18N4O5 — CID 51131854
1-(2,4-dinitrophenyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 51131854) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | 1-(2,4-dinitrophenyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 51131854 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | NC(=O)C1CC2CCCCC2N1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N4O5/c16-15(20)14-7-9-3-1-2-4-11(9)17(14)12-6-5-10(18(21)22)8-13(12)19(23)24/h5-6,8-9,11,14H,1-4,7H2,(H2,16,20) |
| InChIKey | MNPSFEMZUCGMAY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|