C15H18N2O4 — CID 82752626
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-nitrobenzoic acid (PubChem CID 82752626) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-nitrobenzoic acid.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 82752626 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1N1CCC2CCCCC21 |
| InChI | InChI=1S/C15H18N2O4/c18-15(19)12-9-11(17(20)21)5-6-14(12)16-8-7-10-3-1-2-4-13(10)16/h5-6,9-10,13H,1-4,7-8H2,(H,18,19) |
| InChIKey | ZYESISZDWCLRHY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|