C15H17IN2O3 — CID 65319042
2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(2-iodo-5-nitrophenyl)methanone (PubChem CID 65319042) has the molecular formula C15H17IN2O3 and a molecular weight of 400.22 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(2-iodo-5-nitrophenyl)methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(2-iodo-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 65319042 |
| Molecular Formula | C15H17IN2O3 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-(2-iodo-5-nitrophenyl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1I)N1CCCC2CCCC21 |
| InChI | InChI=1S/C15H17IN2O3/c16-13-7-6-11(18(20)21)9-12(13)15(19)17-8-2-4-10-3-1-5-14(10)17/h6-7,9-10,14H,1-5,8H2 |
| InChIKey | JXCOEIXFFZMBRY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|