C16H20FN3O3 — CID 51105630
1-[(5-fluoro-2-nitrophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 51105630) has the molecular formula C16H20FN3O3 and a molecular weight of 321.35 g/mol. Its IUPAC name is 1-[(5-fluoro-2-nitrophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | 1-[(5-fluoro-2-nitrophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 51105630 |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-[(5-fluoro-2-nitrophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | NC(=O)C1CC2CCCCC2N1Cc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20FN3O3/c17-12-5-6-14(20(22)23)11(7-12)9-19-13-4-2-1-3-10(13)8-15(19)16(18)21/h5-7,10,13,15H,1-4,8-9H2,(H2,18,21) |
| InChIKey | KDFOMIYYCVSKNC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|