C21H30N4O5S — CID 52502783
(2R,3aR,7aR)-1-[4-(azepan-1-ylsulfonyl)-2-nitrophenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 52502783) has the molecular formula C21H30N4O5S and a molecular weight of 450.56 g/mol. Its IUPAC name is (2R,3aR,7aR)-1-[4-(azepan-1-ylsulfonyl)-2-nitrophenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2R,3aR,7aR)-1-[4-(azepan-1-ylsulfonyl)-2-nitrophenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 52502783 |
| Molecular Formula | C21H30N4O5S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (2R,3aR,7aR)-1-[4-(azepan-1-ylsulfonyl)-2-nitrophenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | NC(=O)[C@H]1C[C@H]2CCCC[C@H]2N1c1ccc(S(=O)(=O)N2CCCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H30N4O5S/c22-21(26)20-13-15-7-3-4-8-17(15)24(20)18-10-9-16(14-19(18)25(27)28)31(29,30)23-11-5-1-2-6-12-23/h9-10,14-15,17,20H,1-8,11-13H2,(H2,22,26)/t15-,17-,20-/m1/s1 |
| InChIKey | YOKYSNFTJVXTCJ-WRWLIDTKSA-N |
| XLogP | 2.78 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|