methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate

C11H11N3O6S — CID 13162384

IUPACmethyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate
SMILESCOC(=O)C1CSCN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-]
InChIInChI=1S/C11H11N3O6S/c1-20-11(15)10-5-21-6-12(10)8-3-2-7(13(16)17)4-9(8)14(18)19/h2-4,10H,5-6H2,1H3
InChIKeyJHBXYAFQTHKOEJ-UHFFFAOYSA-N
MW313.29 g/mol
LogP1.56
Rot. Bonds4

About methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate

methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 13162384) has the molecular formula C11H11N3O6S and a molecular weight of 313.29 g/mol. Its IUPAC name is methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate.

Molecular Properties

Compound Namemethyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate
PubChem CID13162384
Molecular FormulaC11H11N3O6S
Molecular Weight313.29 g/mol
Exact Mass313.04
IUPAC Namemethyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate
SMILESCOC(=O)C1CSCN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-]
InChIInChI=1S/C11H11N3O6S/c1-20-11(15)10-5-21-6-12(10)8-3-2-7(13(16)17)4-9(8)14(18)19/h2-4,10H,5-6H2,1H3
InChIKeyJHBXYAFQTHKOEJ-UHFFFAOYSA-N
XLogP1.56
TPSA115.82 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.29
LogP ≤ 51.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate?
The IUPAC name of methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate (CID 13162384) is methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate.
What is the SMILES notation for methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate?
The canonical SMILES for methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate is COC(=O)C1CSCN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate?
The InChIKey is JHBXYAFQTHKOEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O6S/c1-20-11(15)10-5-21-6-12(10)8-3-2-7(13(16)17)4-9(8)14(18)19/h2-4,10H,5-6H2,1H3.
What are the key properties of methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate?
methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate has a molecular weight of 313.29 g/mol, XLogP of 1.56, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate is sourced from PubChem (CID 13162384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).