C11H11N3O6S — CID 13162384
methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 13162384) has the molecular formula C11H11N3O6S and a molecular weight of 313.29 g/mol. Its IUPAC name is methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 13162384 |
| Molecular Formula | C11H11N3O6S |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | methyl 3-(2,4-dinitrophenyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | COC(=O)C1CSCN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N3O6S/c1-20-11(15)10-5-21-6-12(10)8-3-2-7(13(16)17)4-9(8)14(18)19/h2-4,10H,5-6H2,1H3 |
| InChIKey | JHBXYAFQTHKOEJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|