C16H13N3O6 — CID 10925945
2-(2,4-dinitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 10925945) has the molecular formula C16H13N3O6 and a molecular weight of 343.30 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 2-(2,4-dinitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10925945 |
| Molecular Formula | C16H13N3O6 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2ccccc2CN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13N3O6/c20-16(21)15-7-10-3-1-2-4-11(10)9-17(15)13-6-5-12(18(22)23)8-14(13)19(24)25/h1-6,8,15H,7,9H2,(H,20,21) |
| InChIKey | YQCPCEPUBHYMAP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|