C16H14FN3O3 — CID 133270513
(3S)-2-(2-fluoro-4-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 133270513) has the molecular formula C16H14FN3O3 and a molecular weight of 315.30 g/mol. Its IUPAC name is (3S)-2-(2-fluoro-4-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-(2-fluoro-4-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 133270513 |
| Molecular Formula | C16H14FN3O3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (3S)-2-(2-fluoro-4-nitrophenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | NC(=O)[C@@H]1Cc2ccccc2CN1c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C16H14FN3O3/c17-13-8-12(20(22)23)5-6-14(13)19-9-11-4-2-1-3-10(11)7-15(19)16(18)21/h1-6,8,15H,7,9H2,(H2,18,21)/t15-/m0/s1 |
| InChIKey | LPVDDAJSWXFPJD-HNNXBMFYSA-N |
| XLogP | 2.15 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|