C14H13FN2O2S — CID 42960310
1-(2-fluoro-4-nitrophenyl)-2-thiophen-2-ylpyrrolidine (PubChem CID 42960310) has the molecular formula C14H13FN2O2S and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-(2-fluoro-4-nitrophenyl)-2-thiophen-2-ylpyrrolidine.
| Compound Name | 1-(2-fluoro-4-nitrophenyl)-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 42960310 |
| Molecular Formula | C14H13FN2O2S |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 1-(2-fluoro-4-nitrophenyl)-2-thiophen-2-ylpyrrolidine |
| SMILES | O=[N+]([O-])c1ccc(N2CCCC2c2cccs2)c(F)c1 |
| InChI | InChI=1S/C14H13FN2O2S/c15-11-9-10(17(18)19)5-6-12(11)16-7-1-3-13(16)14-4-2-8-20-14/h2,4-6,8-9,13H,1,3,7H2 |
| InChIKey | IVCCHTHHFFEJTC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|