C14H14N2O4S2 — CID 43001355
1-(4-nitrophenyl)sulfonyl-2-thiophen-2-ylpyrrolidine (PubChem CID 43001355) has the molecular formula C14H14N2O4S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(4-nitrophenyl)sulfonyl-2-thiophen-2-ylpyrrolidine.
| Compound Name | 1-(4-nitrophenyl)sulfonyl-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 43001355 |
| Molecular Formula | C14H14N2O4S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 1-(4-nitrophenyl)sulfonyl-2-thiophen-2-ylpyrrolidine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCCC2c2cccs2)cc1 |
| InChI | InChI=1S/C14H14N2O4S2/c17-16(18)11-5-7-12(8-6-11)22(19,20)15-9-1-3-13(15)14-4-2-10-21-14/h2,4-8,10,13H,1,3,9H2 |
| InChIKey | DERVOFBKLWDICD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|