C16H18N2O4S2 — CID 92502849
(2S)-1-(2-nitrophenyl)sulfonyl-2-thiophen-2-ylazepane (PubChem CID 92502849) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is (2S)-1-(2-nitrophenyl)sulfonyl-2-thiophen-2-ylazepane.
| Compound Name | (2S)-1-(2-nitrophenyl)sulfonyl-2-thiophen-2-ylazepane |
|---|---|
| PubChem CID | 92502849 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (2S)-1-(2-nitrophenyl)sulfonyl-2-thiophen-2-ylazepane |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1CCCCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C16H18N2O4S2/c19-18(20)14-8-3-4-10-16(14)24(21,22)17-11-5-1-2-7-13(17)15-9-6-12-23-15/h3-4,6,8-10,12-13H,1-2,5,7,11H2/t13-/m0/s1 |
| InChIKey | CGLRQJQUTMJUJR-ZDUSSCGKSA-N |
| XLogP | 3.96 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|